C27H21ClIN3O7S — CID 126067069
methyl 2-[(5Z)-3-(4-chlorophenyl)-5-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 126067069) has the molecular formula C27H21ClIN3O7S and a molecular weight of 693.90 g/mol. Its IUPAC name is methyl 2-[(5Z)-3-(4-chlorophenyl)-5-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(5Z)-3-(4-chlorophenyl)-5-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 126067069 |
| Molecular Formula | C27H21ClIN3O7S |
| Molecular Weight | 693.90 g/mol |
| Exact Mass | 692.98 |
| IUPAC Name | methyl 2-[(5Z)-3-(4-chlorophenyl)-5-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=S)N(c2ccc(Cl)cc2)C(=O)/C1=C/c1cc(I)c(OCc2ccc([N+](=O)[O-])cc2)c(OC)c1 |
| InChI | InChI=1S/C27H21ClIN3O7S/c1-37-23-13-17(11-21(29)25(23)39-15-16-3-7-20(8-4-16)32(35)36)12-22-26(34)31(19-9-5-18(28)6-10-19)27(40)30(22)14-24(33)38-2/h3-13H,14-15H2,1-2H3/b22-12- |
| InChIKey | SRCSHPBYWVPRMO-UUYOSTAYSA-N |
| XLogP | 5.59 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.90 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|