C28H24BrN3O6S — CID 126064720
methyl 2-[(5Z)-5-[[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 126064720) has the molecular formula C28H24BrN3O6S and a molecular weight of 610.49 g/mol. Its IUPAC name is methyl 2-[(5Z)-5-[[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(5Z)-5-[[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 126064720 |
| Molecular Formula | C28H24BrN3O6S |
| Molecular Weight | 610.49 g/mol |
| Exact Mass | 609.06 |
| IUPAC Name | methyl 2-[(5Z)-5-[[5-bromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | CCc1ccc(N2C(=O)/C(=C/c3cc(Br)ccc3OCc3ccc([N+](=O)[O-])cc3)N(CC(=O)OC)C2=S)cc1 |
| InChI | InChI=1S/C28H24BrN3O6S/c1-3-18-4-9-22(10-5-18)31-27(34)24(30(28(31)39)16-26(33)37-2)15-20-14-21(29)8-13-25(20)38-17-19-6-11-23(12-7-19)32(35)36/h4-15H,3,16-17H2,1-2H3/b24-15- |
| InChIKey | NUMZCOIFWFZKON-IWIPYMOSSA-N |
| XLogP | 5.65 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|