C29H26BrN3O7S — CID 126067931
methyl 2-[(5Z)-5-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 126067931) has the molecular formula C29H26BrN3O7S and a molecular weight of 640.51 g/mol. Its IUPAC name is methyl 2-[(5Z)-5-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(5Z)-5-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 126067931 |
| Molecular Formula | C29H26BrN3O7S |
| Molecular Weight | 640.51 g/mol |
| Exact Mass | 639.07 |
| IUPAC Name | methyl 2-[(5Z)-5-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | CCc1ccc(N2C(=O)/C(=C/c3cc(Br)c(OCc4cccc([N+](=O)[O-])c4)c(OC)c3)N(CC(=O)OC)C2=S)cc1 |
| InChI | InChI=1S/C29H26BrN3O7S/c1-4-18-8-10-21(11-9-18)32-28(35)24(31(29(32)41)16-26(34)39-3)14-20-13-23(30)27(25(15-20)38-2)40-17-19-6-5-7-22(12-19)33(36)37/h5-15H,4,16-17H2,1-3H3/b24-14- |
| InChIKey | FHSWYCGGQGYORE-OYKKKHCWSA-N |
| XLogP | 5.65 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|