C28H23BrCl2N2O4S — CID 126074439
methyl 2-[(5Z)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 126074439) has the molecular formula C28H23BrCl2N2O4S and a molecular weight of 634.38 g/mol. Its IUPAC name is methyl 2-[(5Z)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(5Z)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 126074439 |
| Molecular Formula | C28H23BrCl2N2O4S |
| Molecular Weight | 634.38 g/mol |
| Exact Mass | 631.99 |
| IUPAC Name | methyl 2-[(5Z)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | CCc1ccc(N2C(=O)/C(=C/c3cc(Br)ccc3OCc3ccc(Cl)c(Cl)c3)N(CC(=O)OC)C2=S)cc1 |
| InChI | InChI=1S/C28H23BrCl2N2O4S/c1-3-17-4-8-21(9-5-17)33-27(35)24(32(28(33)38)15-26(34)36-2)14-19-13-20(29)7-11-25(19)37-16-18-6-10-22(30)23(31)12-18/h4-14H,3,15-16H2,1-2H3/b24-14- |
| InChIKey | JXVSUDJADFMZGF-OYKKKHCWSA-N |
| XLogP | 7.04 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.38 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|