C24H17BrCl2N2O2S — CID 126038257
(5Z)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126038257) has the molecular formula C24H17BrCl2N2O2S and a molecular weight of 548.29 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126038257 |
| Molecular Formula | C24H17BrCl2N2O2S |
| Molecular Weight | 548.29 g/mol |
| Exact Mass | 545.96 |
| IUPAC Name | (5Z)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=S)N(c2ccccc2)C(=O)/C1=C/c1cc(Br)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H17BrCl2N2O2S/c1-28-21(23(30)29(24(28)32)18-5-3-2-4-6-18)13-16-12-17(25)8-10-22(16)31-14-15-7-9-19(26)20(27)11-15/h2-13H,14H2,1H3/b21-13- |
| InChIKey | AVAZLELSHKFODZ-BKUYFWCQSA-N |
| XLogP | 6.94 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.29 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|