C23H14BrCl3N2O3 — CID 126075797
(5E)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(3-chlorophenyl)imidazolidine-2,4-dione (PubChem CID 126075797) has the molecular formula C23H14BrCl3N2O3 and a molecular weight of 552.64 g/mol. Its IUPAC name is (5E)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(3-chlorophenyl)imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(3-chlorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126075797 |
| Molecular Formula | C23H14BrCl3N2O3 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 549.93 |
| IUPAC Name | (5E)-5-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-(3-chlorophenyl)imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cc(Br)ccc2OCc2ccc(Cl)c(Cl)c2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H14BrCl3N2O3/c24-15-5-7-21(32-12-13-4-6-18(26)19(27)8-13)14(9-15)10-20-22(30)29(23(31)28-20)17-3-1-2-16(25)11-17/h1-11H,12H2,(H,28,31)/b20-10+ |
| InChIKey | XPYKCOVUCJVVOY-KEBDBYFISA-N |
| XLogP | 7.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|