C24H16ClN2O5- — CID 6959041
4-[[2-[(E)-[1-(3-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoate (PubChem CID 6959041) has the molecular formula C24H16ClN2O5- and a molecular weight of 447.85 g/mol. Its IUPAC name is 4-[[2-[(E)-[1-(3-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoate.
| Compound Name | 4-[[2-[(E)-[1-(3-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 6959041 |
| Molecular Formula | C24H16ClN2O5- |
| Molecular Weight | 447.85 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 4-[[2-[(E)-[1-(3-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]methyl]benzoate |
| SMILES | O=C([O-])c1ccc(COc2ccccc2/C=C2/NC(=O)N(c3cccc(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C24H17ClN2O5/c25-18-5-3-6-19(13-18)27-22(28)20(26-24(27)31)12-17-4-1-2-7-21(17)32-14-15-8-10-16(11-9-15)23(29)30/h1-13H,14H2,(H,26,31)(H,29,30)/p-1/b20-12+ |
| InChIKey | UYEWDPJAFUDTGQ-UDWIEESQSA-M |
| XLogP | 3.38 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.85 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|