C24H18BrIN2O2S — CID 126048175
(5Z)-5-[[3-bromo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126048175) has the molecular formula C24H18BrIN2O2S and a molecular weight of 605.30 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[3-bromo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126048175 |
| Molecular Formula | C24H18BrIN2O2S |
| Molecular Weight | 605.30 g/mol |
| Exact Mass | 603.93 |
| IUPAC Name | (5Z)-5-[[3-bromo-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=S)N(c2ccccc2)C(=O)/C1=C/c1ccc(OCc2ccc(I)cc2)c(Br)c1 |
| InChI | InChI=1S/C24H18BrIN2O2S/c1-27-21(23(29)28(24(27)31)19-5-3-2-4-6-19)14-17-9-12-22(20(25)13-17)30-15-16-7-10-18(26)11-8-16/h2-14H,15H2,1H3/b21-14- |
| InChIKey | JMGKUSQFSKUCEH-STZFKDTASA-N |
| XLogP | 6.24 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.30 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|