C24H17Br2FN2O2S — CID 126036184
(5Z)-5-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126036184) has the molecular formula C24H17Br2FN2O2S and a molecular weight of 576.29 g/mol. Its IUPAC name is (5Z)-5-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126036184 |
| Molecular Formula | C24H17Br2FN2O2S |
| Molecular Weight | 576.29 g/mol |
| Exact Mass | 573.94 |
| IUPAC Name | (5Z)-5-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=S)N(c2ccccc2)C(=O)/C1=C/c1cc(Br)c(OCc2cccc(F)c2)c(Br)c1 |
| InChI | InChI=1S/C24H17Br2FN2O2S/c1-28-21(23(30)29(24(28)32)18-8-3-2-4-9-18)13-16-11-19(25)22(20(26)12-16)31-14-15-6-5-7-17(27)10-15/h2-13H,14H2,1H3/b21-13- |
| InChIKey | BEGKASJDNCJLCT-BKUYFWCQSA-N |
| XLogP | 6.53 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.29 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|