C21H21FN2O3S — CID 1290183
(5E)-5-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 1290183) has the molecular formula C21H21FN2O3S and a molecular weight of 400.48 g/mol. Its IUPAC name is (5E)-5-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 1290183 |
| Molecular Formula | C21H21FN2O3S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (5E)-5-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\C(=O)N(C)C(=S)N2C)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C21H21FN2O3S/c1-4-26-19-12-14(11-17-20(25)24(3)21(28)23(17)2)8-9-18(19)27-13-15-6-5-7-16(22)10-15/h5-12H,4,13H2,1-3H3/b17-11+ |
| InChIKey | VBHSXVLSEMAJCG-GZTJUZNOSA-N |
| XLogP | 3.83 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|