C19H15Cl3N2O2S — CID 126052355
(5Z)-5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126052355) has the molecular formula C19H15Cl3N2O2S and a molecular weight of 441.77 g/mol. Its IUPAC name is (5Z)-5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126052355 |
| Molecular Formula | C19H15Cl3N2O2S |
| Molecular Weight | 441.77 g/mol |
| Exact Mass | 439.99 |
| IUPAC Name | (5Z)-5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=O)/C(=C/c2ccc(OCc3ccc(Cl)c(Cl)c3)c(Cl)c2)N(C)C1=S |
| InChI | InChI=1S/C19H15Cl3N2O2S/c1-23-16(18(25)24(2)19(23)27)9-11-4-6-17(15(22)7-11)26-10-12-3-5-13(20)14(21)8-12/h3-9H,10H2,1-2H3/b16-9- |
| InChIKey | QCDDKQCUYUAFEH-SXGWCWSVSA-N |
| XLogP | 5.26 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.77 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|