C17H13Cl3O3 — CID 91684816
methyl (E)-3-[3-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 91684816) has the molecular formula C17H13Cl3O3 and a molecular weight of 371.65 g/mol. Its IUPAC name is methyl (E)-3-[3-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91684816 |
| Molecular Formula | C17H13Cl3O3 |
| Molecular Weight | 371.65 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | methyl (E)-3-[3-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(OCc2ccc(Cl)c(Cl)c2)c(Cl)c1 |
| InChI | InChI=1S/C17H13Cl3O3/c1-22-17(21)7-4-11-3-6-16(15(20)8-11)23-10-12-2-5-13(18)14(19)9-12/h2-9H,10H2,1H3/b7-4+ |
| InChIKey | RPLPXRHRMPOWQK-QPJJXVBHSA-N |
| XLogP | 5.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.65 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|