C17H12BrCl3O3 — CID 91686132
methyl (E)-3-[3-bromo-5-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 91686132) has the molecular formula C17H12BrCl3O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is methyl (E)-3-[3-bromo-5-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-bromo-5-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91686132 |
| Molecular Formula | C17H12BrCl3O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 447.90 |
| IUPAC Name | methyl (E)-3-[3-bromo-5-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(Cl)c(OCc2ccc(Cl)c(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C17H12BrCl3O3/c1-23-16(22)5-3-10-6-12(18)17(15(21)7-10)24-9-11-2-4-13(19)14(20)8-11/h2-8H,9H2,1H3/b5-3+ |
| InChIKey | DFDNSDMAAQJOKG-HWKANZROSA-N |
| XLogP | 6.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|