C16H12BrCl2NO2 — CID 91684801
(E)-3-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 91684801) has the molecular formula C16H12BrCl2NO2 and a molecular weight of 401.09 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 91684801 |
| Molecular Formula | C16H12BrCl2NO2 |
| Molecular Weight | 401.09 g/mol |
| Exact Mass | 398.94 |
| IUPAC Name | (E)-3-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1ccc(OCc2ccc(Cl)c(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C16H12BrCl2NO2/c17-12-7-10(3-6-16(20)21)2-5-15(12)22-9-11-1-4-13(18)14(19)8-11/h1-8H,9H2,(H2,20,21)/b6-3+ |
| InChIKey | JVVZGWSYTNZJRL-ZZXKWVIFSA-N |
| XLogP | 4.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.09 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|