C16H9BrCl4O2 — CID 91686134
(E)-3-[3-bromo-5-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enoyl chloride (PubChem CID 91686134) has the molecular formula C16H9BrCl4O2 and a molecular weight of 454.96 g/mol. Its IUPAC name is (E)-3-[3-bromo-5-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enoyl chloride.
| Compound Name | (E)-3-[3-bromo-5-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enoyl chloride |
|---|---|
| PubChem CID | 91686134 |
| Molecular Formula | C16H9BrCl4O2 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 451.85 |
| IUPAC Name | (E)-3-[3-bromo-5-chloro-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enoyl chloride |
| SMILES | O=C(Cl)/C=C/c1cc(Cl)c(OCc2ccc(Cl)c(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C16H9BrCl4O2/c17-11-5-9(2-4-15(21)22)6-14(20)16(11)23-8-10-1-3-12(18)13(19)7-10/h1-7H,8H2/b4-2+ |
| InChIKey | LLSVRYUZYZLQCU-DUXPYHPUSA-N |
| XLogP | 6.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|