C16H13Br2Cl2NO2 — CID 70592651
3-amino-1-[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-1-en-2-ol (PubChem CID 70592651) has the molecular formula C16H13Br2Cl2NO2 and a molecular weight of 482.00 g/mol. Its IUPAC name is 3-amino-1-[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-1-en-2-ol.
| Compound Name | 3-amino-1-[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-1-en-2-ol |
|---|---|
| PubChem CID | 70592651 |
| Molecular Formula | C16H13Br2Cl2NO2 |
| Molecular Weight | 482.00 g/mol |
| Exact Mass | 478.87 |
| IUPAC Name | 3-amino-1-[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]prop-1-en-2-ol |
| SMILES | NCC(O)=Cc1cc(Br)c(OCc2ccc(Cl)c(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C16H13Br2Cl2NO2/c17-12-4-10(3-11(22)7-21)5-13(18)16(12)23-8-9-1-2-14(19)15(20)6-9/h1-6,22H,7-8,21H2 |
| InChIKey | MMLLXPPQZIGUHW-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.00 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|