C19H14BrCl2N3O4 — CID 126252124
(Z)-3-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-N-carbamoyl-2-cyanoprop-2-enamide (PubChem CID 126252124) has the molecular formula C19H14BrCl2N3O4 and a molecular weight of 499.15 g/mol. Its IUPAC name is (Z)-3-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-N-carbamoyl-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-N-carbamoyl-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 126252124 |
| Molecular Formula | C19H14BrCl2N3O4 |
| Molecular Weight | 499.15 g/mol |
| Exact Mass | 496.95 |
| IUPAC Name | (Z)-3-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-N-carbamoyl-2-cyanoprop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)NC(N)=O)cc(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H14BrCl2N3O4/c1-28-16-7-11(4-12(8-23)18(26)25-19(24)27)5-13(20)17(16)29-9-10-2-3-14(21)15(22)6-10/h2-7H,9H2,1H3,(H3,24,25,26,27)/b12-4- |
| InChIKey | BFCFTNMIFCKEHX-QCDXTXTGSA-N |
| XLogP | 4.45 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.15 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|