C14H11BrCl2N2O2 — CID 91683383
3-bromo-4-[(3,4-dichlorophenyl)methoxy]benzohydrazide (PubChem CID 91683383) has the molecular formula C14H11BrCl2N2O2 and a molecular weight of 390.06 g/mol. Its IUPAC name is 3-bromo-4-[(3,4-dichlorophenyl)methoxy]benzohydrazide.
| Compound Name | 3-bromo-4-[(3,4-dichlorophenyl)methoxy]benzohydrazide |
|---|---|
| PubChem CID | 91683383 |
| Molecular Formula | C14H11BrCl2N2O2 |
| Molecular Weight | 390.06 g/mol |
| Exact Mass | 387.94 |
| IUPAC Name | 3-bromo-4-[(3,4-dichlorophenyl)methoxy]benzohydrazide |
| SMILES | NNC(=O)c1ccc(OCc2ccc(Cl)c(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C14H11BrCl2N2O2/c15-10-6-9(14(20)19-18)2-4-13(10)21-7-8-1-3-11(16)12(17)5-8/h1-6H,7,18H2,(H,19,20) |
| InChIKey | XFIKMDTYVCSSIK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.06 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|