C15H13Cl2NO3 — CID 6458100
4-[(3,4-dichlorophenyl)methoxy]-3-methoxybenzamide (PubChem CID 6458100) has the molecular formula C15H13Cl2NO3 and a molecular weight of 326.18 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methoxy]-3-methoxybenzamide.
| Compound Name | 4-[(3,4-dichlorophenyl)methoxy]-3-methoxybenzamide |
|---|---|
| PubChem CID | 6458100 |
| Molecular Formula | C15H13Cl2NO3 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methoxy]-3-methoxybenzamide |
| SMILES | COc1cc(C(N)=O)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2NO3/c1-20-14-7-10(15(18)19)3-5-13(14)21-8-9-2-4-11(16)12(17)6-9/h2-7H,8H2,1H3,(H2,18,19) |
| InChIKey | CZRDJLSCQRXPHA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |