C16H15Cl2NO2S — CID 20988291
4-[(3,4-dichlorophenyl)methoxy]-3-ethoxybenzenecarbothioamide (PubChem CID 20988291) has the molecular formula C16H15Cl2NO2S and a molecular weight of 356.27 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methoxy]-3-ethoxybenzenecarbothioamide.
| Compound Name | 4-[(3,4-dichlorophenyl)methoxy]-3-ethoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 20988291 |
| Molecular Formula | C16H15Cl2NO2S |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methoxy]-3-ethoxybenzenecarbothioamide |
| SMILES | CCOc1cc(C(N)=S)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2NO2S/c1-2-20-15-8-11(16(19)22)4-6-14(15)21-9-10-3-5-12(17)13(18)7-10/h3-8H,2,9H2,1H3,(H2,19,22) |
| InChIKey | JWSZHGMJAXPRQZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|