C19H17Cl2NO3S2 — CID 143517957
[(E)-3-amino-1-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-3-oxoprop-1-en-2-yl] methanedithioate (PubChem CID 143517957) has the molecular formula C19H17Cl2NO3S2 and a molecular weight of 442.39 g/mol. Its IUPAC name is [(E)-3-amino-1-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-3-oxoprop-1-en-2-yl] methanedithioate.
| Compound Name | [(E)-3-amino-1-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-3-oxoprop-1-en-2-yl] methanedithioate |
|---|---|
| PubChem CID | 143517957 |
| Molecular Formula | C19H17Cl2NO3S2 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | [(E)-3-amino-1-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-3-oxoprop-1-en-2-yl] methanedithioate |
| SMILES | CCOc1cc(/C=C(/SC=S)C(N)=O)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H17Cl2NO3S2/c1-2-24-17-8-12(9-18(19(22)23)27-11-26)4-6-16(17)25-10-13-3-5-14(20)15(21)7-13/h3-9,11H,2,10H2,1H3,(H2,22,23)/b18-9+ |
| InChIKey | JMMPBASIIJRYIY-GIJQJNRQSA-N |
| XLogP | 5.49 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|