C19H16Cl2O4 — CID 91683453
prop-2-ynyl 4-[(3,4-dichlorophenyl)methoxy]-3-ethoxybenzoate (PubChem CID 91683453) has the molecular formula C19H16Cl2O4 and a molecular weight of 379.24 g/mol. Its IUPAC name is prop-2-ynyl 4-[(3,4-dichlorophenyl)methoxy]-3-ethoxybenzoate.
| Compound Name | prop-2-ynyl 4-[(3,4-dichlorophenyl)methoxy]-3-ethoxybenzoate |
|---|---|
| PubChem CID | 91683453 |
| Molecular Formula | C19H16Cl2O4 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | prop-2-ynyl 4-[(3,4-dichlorophenyl)methoxy]-3-ethoxybenzoate |
| SMILES | C#CCOC(=O)c1ccc(OCc2ccc(Cl)c(Cl)c2)c(OCC)c1 |
| InChI | InChI=1S/C19H16Cl2O4/c1-3-9-24-19(22)14-6-8-17(18(11-14)23-4-2)25-12-13-5-7-15(20)16(21)10-13/h1,5-8,10-11H,4,9,12H2,2H3 |
| InChIKey | DYABVUNVZJIPKA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|