C19H19Cl2NO3S — CID 23961778
[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-morpholin-4-ylmethanethione (PubChem CID 23961778) has the molecular formula C19H19Cl2NO3S and a molecular weight of 412.34 g/mol. Its IUPAC name is [4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-morpholin-4-ylmethanethione.
| Compound Name | [4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-morpholin-4-ylmethanethione |
|---|---|
| PubChem CID | 23961778 |
| Molecular Formula | C19H19Cl2NO3S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | [4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-morpholin-4-ylmethanethione |
| SMILES | COc1cc(C(=S)N2CCOCC2)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H19Cl2NO3S/c1-23-18-11-14(19(26)22-6-8-24-9-7-22)3-5-17(18)25-12-13-2-4-15(20)16(21)10-13/h2-5,10-11H,6-9,12H2,1H3 |
| InChIKey | JPPSABOCHIVJFN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|