C26H27BrN2O2S — CID 126374224
(4-benzylpiperazin-1-yl)-[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methanethione (PubChem CID 126374224) has the molecular formula C26H27BrN2O2S and a molecular weight of 511.49 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methanethione.
| Compound Name | (4-benzylpiperazin-1-yl)-[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methanethione |
|---|---|
| PubChem CID | 126374224 |
| Molecular Formula | C26H27BrN2O2S |
| Molecular Weight | 511.49 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methanethione |
| SMILES | COc1cc(C(=S)N2CCN(Cc3ccccc3)CC2)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C26H27BrN2O2S/c1-30-25-17-22(9-12-24(25)31-19-21-7-10-23(27)11-8-21)26(32)29-15-13-28(14-16-29)18-20-5-3-2-4-6-20/h2-12,17H,13-16,18-19H2,1H3 |
| InChIKey | QANQIZIQRUZWDN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|