C24H32N2O2S — CID 4646277
(4-benzylpiperazin-1-yl)-[3-ethoxy-4-(2-methylpropoxy)phenyl]methanethione (PubChem CID 4646277) has the molecular formula C24H32N2O2S and a molecular weight of 412.60 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[3-ethoxy-4-(2-methylpropoxy)phenyl]methanethione.
| Compound Name | (4-benzylpiperazin-1-yl)-[3-ethoxy-4-(2-methylpropoxy)phenyl]methanethione |
|---|---|
| PubChem CID | 4646277 |
| Molecular Formula | C24H32N2O2S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[3-ethoxy-4-(2-methylpropoxy)phenyl]methanethione |
| SMILES | CCOc1cc(C(=S)N2CCN(Cc3ccccc3)CC2)ccc1OCC(C)C |
| InChI | InChI=1S/C24H32N2O2S/c1-4-27-23-16-21(10-11-22(23)28-18-19(2)3)24(29)26-14-12-25(13-15-26)17-20-8-6-5-7-9-20/h5-11,16,19H,4,12-15,17-18H2,1-3H3 |
| InChIKey | CLZOMGQXEBVGBX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|