C20H22Cl2N2OS — CID 4003675
(4-benzylpiperazin-1-yl)-(3,5-dichloro-4-ethoxyphenyl)methanethione (PubChem CID 4003675) has the molecular formula C20H22Cl2N2OS and a molecular weight of 409.38 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-(3,5-dichloro-4-ethoxyphenyl)methanethione.
| Compound Name | (4-benzylpiperazin-1-yl)-(3,5-dichloro-4-ethoxyphenyl)methanethione |
|---|---|
| PubChem CID | 4003675 |
| Molecular Formula | C20H22Cl2N2OS |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-(3,5-dichloro-4-ethoxyphenyl)methanethione |
| SMILES | CCOc1c(Cl)cc(C(=S)N2CCN(Cc3ccccc3)CC2)cc1Cl |
| InChI | InChI=1S/C20H22Cl2N2OS/c1-2-25-19-17(21)12-16(13-18(19)22)20(26)24-10-8-23(9-11-24)14-15-6-4-3-5-7-15/h3-7,12-13H,2,8-11,14H2,1H3 |
| InChIKey | YNJXQVQWGUFTAE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|