C26H26ClN3O4S — CID 126377915
(4-benzylpiperazin-1-yl)-[3-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methanethione (PubChem CID 126377915) has the molecular formula C26H26ClN3O4S and a molecular weight of 512.03 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[3-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methanethione.
| Compound Name | (4-benzylpiperazin-1-yl)-[3-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methanethione |
|---|---|
| PubChem CID | 126377915 |
| Molecular Formula | C26H26ClN3O4S |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[3-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methanethione |
| SMILES | COc1cc(C(=S)N2CCN(Cc3ccccc3)CC2)cc(Cl)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H26ClN3O4S/c1-33-24-16-21(15-23(27)25(24)34-18-20-7-9-22(10-8-20)30(31)32)26(35)29-13-11-28(12-14-29)17-19-5-3-2-4-6-19/h2-10,15-16H,11-14,17-18H2,1H3 |
| InChIKey | UAQZPNBIORIMRZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 68.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|