C26H23Cl2N3OS — CID 3496942
2-[[4-(4-benzylpiperazine-1-carbothioyl)-2,6-dichlorophenoxy]methyl]benzonitrile (PubChem CID 3496942) has the molecular formula C26H23Cl2N3OS and a molecular weight of 496.46 g/mol. Its IUPAC name is 2-[[4-(4-benzylpiperazine-1-carbothioyl)-2,6-dichlorophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-(4-benzylpiperazine-1-carbothioyl)-2,6-dichlorophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 3496942 |
| Molecular Formula | C26H23Cl2N3OS |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | 2-[[4-(4-benzylpiperazine-1-carbothioyl)-2,6-dichlorophenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1c(Cl)cc(C(=S)N2CCN(Cc3ccccc3)CC2)cc1Cl |
| InChI | InChI=1S/C26H23Cl2N3OS/c27-23-14-22(15-24(28)25(23)32-18-21-9-5-4-8-20(21)16-29)26(33)31-12-10-30(11-13-31)17-19-6-2-1-3-7-19/h1-9,14-15H,10-13,17-18H2 |
| InChIKey | JLLURNGTRKGTSP-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|