C18H16Cl3NO2S — CID 3909592
[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]-morpholin-4-ylmethanethione (PubChem CID 3909592) has the molecular formula C18H16Cl3NO2S and a molecular weight of 416.76 g/mol. Its IUPAC name is [3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]-morpholin-4-ylmethanethione.
| Compound Name | [3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]-morpholin-4-ylmethanethione |
|---|---|
| PubChem CID | 3909592 |
| Molecular Formula | C18H16Cl3NO2S |
| Molecular Weight | 416.76 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | [3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]-morpholin-4-ylmethanethione |
| SMILES | S=C(c1cc(Cl)c(OCc2ccccc2Cl)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C18H16Cl3NO2S/c19-14-4-2-1-3-12(14)11-24-17-15(20)9-13(10-16(17)21)18(25)22-5-7-23-8-6-22/h1-4,9-10H,5-8,11H2 |
| InChIKey | OIJBSEFNNJXOBD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.76 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|