C19H19BrClNO3S — CID 5216829
[2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-morpholin-4-ylmethanethione (PubChem CID 5216829) has the molecular formula C19H19BrClNO3S and a molecular weight of 456.79 g/mol. Its IUPAC name is [2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-morpholin-4-ylmethanethione.
| Compound Name | [2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-morpholin-4-ylmethanethione |
|---|---|
| PubChem CID | 5216829 |
| Molecular Formula | C19H19BrClNO3S |
| Molecular Weight | 456.79 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | [2-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]-morpholin-4-ylmethanethione |
| SMILES | COc1cc(C(=S)N2CCOCC2)c(Br)cc1OCc1ccccc1Cl |
| InChI | InChI=1S/C19H19BrClNO3S/c1-23-17-10-14(19(26)22-6-8-24-9-7-22)15(20)11-18(17)25-12-13-4-2-3-5-16(13)21/h2-5,10-11H,6-9,12H2,1H3 |
| InChIKey | MRGNPNLKOSDIAT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.79 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|