C21H23Br2NO2S — CID 126372216
[2-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]-(4-methylpiperidin-1-yl)methanethione (PubChem CID 126372216) has the molecular formula C21H23Br2NO2S and a molecular weight of 513.30 g/mol. Its IUPAC name is [2-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]-(4-methylpiperidin-1-yl)methanethione.
| Compound Name | [2-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]-(4-methylpiperidin-1-yl)methanethione |
|---|---|
| PubChem CID | 126372216 |
| Molecular Formula | C21H23Br2NO2S |
| Molecular Weight | 513.30 g/mol |
| Exact Mass | 510.98 |
| IUPAC Name | [2-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]-(4-methylpiperidin-1-yl)methanethione |
| SMILES | COc1cc(C(=S)N2CCC(C)CC2)c(Br)cc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H23Br2NO2S/c1-14-7-9-24(10-8-14)21(27)17-11-19(25-2)20(12-18(17)23)26-13-15-3-5-16(22)6-4-15/h3-6,11-12,14H,7-10,13H2,1-2H3 |
| InChIKey | AMIHERUMNBSBGJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.30 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|