C20H21ClFNOS — CID 4640773
[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]-(4-methylpiperidin-1-yl)methanethione (PubChem CID 4640773) has the molecular formula C20H21ClFNOS and a molecular weight of 377.91 g/mol. Its IUPAC name is [3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]-(4-methylpiperidin-1-yl)methanethione.
| Compound Name | [3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]-(4-methylpiperidin-1-yl)methanethione |
|---|---|
| PubChem CID | 4640773 |
| Molecular Formula | C20H21ClFNOS |
| Molecular Weight | 377.91 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]-(4-methylpiperidin-1-yl)methanethione |
| SMILES | CC1CCN(C(=S)c2ccc(OCc3ccc(F)cc3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H21ClFNOS/c1-14-8-10-23(11-9-14)20(25)16-4-7-19(18(21)12-16)24-13-15-2-5-17(22)6-3-15/h2-7,12,14H,8-11,13H2,1H3 |
| InChIKey | ZQASFDZOFAOREO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.91 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|