C21H23Br2NOS — CID 3621364
[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]-(4-methylpiperidin-1-yl)methanethione (PubChem CID 3621364) has the molecular formula C21H23Br2NOS and a molecular weight of 497.30 g/mol. Its IUPAC name is [3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]-(4-methylpiperidin-1-yl)methanethione.
| Compound Name | [3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]-(4-methylpiperidin-1-yl)methanethione |
|---|---|
| PubChem CID | 3621364 |
| Molecular Formula | C21H23Br2NOS |
| Molecular Weight | 497.30 g/mol |
| Exact Mass | 494.99 |
| IUPAC Name | [3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]-(4-methylpiperidin-1-yl)methanethione |
| SMILES | Cc1ccc(COc2c(Br)cc(C(=S)N3CCC(C)CC3)cc2Br)cc1 |
| InChI | InChI=1S/C21H23Br2NOS/c1-14-3-5-16(6-4-14)13-25-20-18(22)11-17(12-19(20)23)21(26)24-9-7-15(2)8-10-24/h3-6,11-12,15H,7-10,13H2,1-2H3 |
| InChIKey | YAIAVUUIAUNASF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.30 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|