C27H28BrFN2O2S — CID 126373362
(4-benzylpiperazin-1-yl)-[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methanethione (PubChem CID 126373362) has the molecular formula C27H28BrFN2O2S and a molecular weight of 543.50 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methanethione.
| Compound Name | (4-benzylpiperazin-1-yl)-[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methanethione |
|---|---|
| PubChem CID | 126373362 |
| Molecular Formula | C27H28BrFN2O2S |
| Molecular Weight | 543.50 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methanethione |
| SMILES | CCOc1cc(C(=S)N2CCN(Cc3ccccc3)CC2)cc(Br)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C27H28BrFN2O2S/c1-2-32-25-17-22(16-24(28)26(25)33-19-21-8-10-23(29)11-9-21)27(34)31-14-12-30(13-15-31)18-20-6-4-3-5-7-20/h3-11,16-17H,2,12-15,18-19H2,1H3 |
| InChIKey | JOAFAOWYDLJTOY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|