C22H27BrN2O2S — CID 3913014
(4-benzylpiperazin-1-yl)-(3-bromo-4,5-diethoxyphenyl)methanethione (PubChem CID 3913014) has the molecular formula C22H27BrN2O2S and a molecular weight of 463.44 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-(3-bromo-4,5-diethoxyphenyl)methanethione.
| Compound Name | (4-benzylpiperazin-1-yl)-(3-bromo-4,5-diethoxyphenyl)methanethione |
|---|---|
| PubChem CID | 3913014 |
| Molecular Formula | C22H27BrN2O2S |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-(3-bromo-4,5-diethoxyphenyl)methanethione |
| SMILES | CCOc1cc(C(=S)N2CCN(Cc3ccccc3)CC2)cc(Br)c1OCC |
| InChI | InChI=1S/C22H27BrN2O2S/c1-3-26-20-15-18(14-19(23)21(20)27-4-2)22(28)25-12-10-24(11-13-25)16-17-8-6-5-7-9-17/h5-9,14-15H,3-4,10-13,16H2,1-2H3 |
| InChIKey | SFIGCMQMAJCXHY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|