C24H33N3O4 — CID 108869729
4-benzyl-N-(3,4,5-triethoxyphenyl)piperazine-1-carboxamide (PubChem CID 108869729) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-benzyl-N-(3,4,5-triethoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-benzyl-N-(3,4,5-triethoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108869729 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 4-benzyl-N-(3,4,5-triethoxyphenyl)piperazine-1-carboxamide |
| SMILES | CCOc1cc(NC(=O)N2CCN(Cc3ccccc3)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H33N3O4/c1-4-29-21-16-20(17-22(30-5-2)23(21)31-6-3)25-24(28)27-14-12-26(13-15-27)18-19-10-8-7-9-11-19/h7-11,16-17H,4-6,12-15,18H2,1-3H3,(H,25,28) |
| InChIKey | VKHWLQDGZGNPLV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |