C25H33N3O4 — CID 4244582
N-[(1-benzylpiperidin-4-ylidene)amino]-3,4,5-triethoxybenzamide (PubChem CID 4244582) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-ylidene)amino]-3,4,5-triethoxybenzamide.
| Compound Name | N-[(1-benzylpiperidin-4-ylidene)amino]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 4244582 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | N-[(1-benzylpiperidin-4-ylidene)amino]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NN=C2CCN(Cc3ccccc3)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H33N3O4/c1-4-30-22-16-20(17-23(31-5-2)24(22)32-6-3)25(29)27-26-21-12-14-28(15-13-21)18-19-10-8-7-9-11-19/h7-11,16-17H,4-6,12-15,18H2,1-3H3,(H,27,29) |
| InChIKey | XWPHWTNZJGEEFL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|