C19H19Cl2N3O — CID 1219274
N-[(1-benzylpiperidin-4-ylidene)amino]-2,4-dichlorobenzamide (PubChem CID 1219274) has the molecular formula C19H19Cl2N3O and a molecular weight of 376.29 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-ylidene)amino]-2,4-dichlorobenzamide.
| Compound Name | N-[(1-benzylpiperidin-4-ylidene)amino]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 1219274 |
| Molecular Formula | C19H19Cl2N3O |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-[(1-benzylpiperidin-4-ylidene)amino]-2,4-dichlorobenzamide |
| SMILES | O=C(NN=C1CCN(Cc2ccccc2)CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl2N3O/c20-15-6-7-17(18(21)12-15)19(25)23-22-16-8-10-24(11-9-16)13-14-4-2-1-3-5-14/h1-7,12H,8-11,13H2,(H,23,25) |
| InChIKey | YVFUOFDSERSMKH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|