C22H22ClN3OS — CID 5058858
N-[(1-benzylpiperidin-4-ylidene)amino]-3-chloro-6-methyl-1-benzothiophene-2-carboxamide (PubChem CID 5058858) has the molecular formula C22H22ClN3OS and a molecular weight of 411.96 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-ylidene)amino]-3-chloro-6-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(1-benzylpiperidin-4-ylidene)amino]-3-chloro-6-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 5058858 |
| Molecular Formula | C22H22ClN3OS |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | N-[(1-benzylpiperidin-4-ylidene)amino]-3-chloro-6-methyl-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2c(Cl)c(C(=O)NN=C3CCN(Cc4ccccc4)CC3)sc2c1 |
| InChI | InChI=1S/C22H22ClN3OS/c1-15-7-8-18-19(13-15)28-21(20(18)23)22(27)25-24-17-9-11-26(12-10-17)14-16-5-3-2-4-6-16/h2-8,13H,9-12,14H2,1H3,(H,25,27) |
| InChIKey | YHXWPQYCFLXUSO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|