C21H24ClN3OS — CID 126335040
(2S)-N-[(1-benzylpiperidin-4-ylidene)amino]-2-(4-chlorophenyl)sulfanylpropanamide (PubChem CID 126335040) has the molecular formula C21H24ClN3OS and a molecular weight of 401.96 g/mol. Its IUPAC name is (2S)-N-[(1-benzylpiperidin-4-ylidene)amino]-2-(4-chlorophenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-[(1-benzylpiperidin-4-ylidene)amino]-2-(4-chlorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 126335040 |
| Molecular Formula | C21H24ClN3OS |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (2S)-N-[(1-benzylpiperidin-4-ylidene)amino]-2-(4-chlorophenyl)sulfanylpropanamide |
| SMILES | C[C@H](Sc1ccc(Cl)cc1)C(=O)NN=C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H24ClN3OS/c1-16(27-20-9-7-18(22)8-10-20)21(26)24-23-19-11-13-25(14-12-19)15-17-5-3-2-4-6-17/h2-10,16H,11-15H2,1H3,(H,24,26)/t16-/m0/s1 |
| InChIKey | BZMGZOHWRSFOLV-INIZCTEOSA-N |
| XLogP | 4.59 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|