C22H27N3OS — CID 126354048
(2R)-N-[(1-benzylpiperidin-4-ylidene)amino]-2-benzylsulfanylpropanamide (PubChem CID 126354048) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is (2R)-N-[(1-benzylpiperidin-4-ylidene)amino]-2-benzylsulfanylpropanamide.
| Compound Name | (2R)-N-[(1-benzylpiperidin-4-ylidene)amino]-2-benzylsulfanylpropanamide |
|---|---|
| PubChem CID | 126354048 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (2R)-N-[(1-benzylpiperidin-4-ylidene)amino]-2-benzylsulfanylpropanamide |
| SMILES | C[C@@H](SCc1ccccc1)C(=O)NN=C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H27N3OS/c1-18(27-17-20-10-6-3-7-11-20)22(26)24-23-21-12-14-25(15-13-21)16-19-8-4-2-5-9-19/h2-11,18H,12-17H2,1H3,(H,24,26)/t18-/m1/s1 |
| InChIKey | RSTJYDLYRDGKBG-GOSISDBHSA-N |
| XLogP | 4.08 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|