C20H30N2O4 — CID 5102951
3,4,5-triethoxy-N-[(4-methylcyclohexylidene)amino]benzamide (PubChem CID 5102951) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(4-methylcyclohexylidene)amino]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[(4-methylcyclohexylidene)amino]benzamide |
|---|---|
| PubChem CID | 5102951 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 3,4,5-triethoxy-N-[(4-methylcyclohexylidene)amino]benzamide |
| SMILES | CCOc1cc(C(=O)NN=C2CCC(C)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H30N2O4/c1-5-24-17-12-15(13-18(25-6-2)19(17)26-7-3)20(23)22-21-16-10-8-14(4)9-11-16/h12-14H,5-11H2,1-4H3,(H,22,23)/b21-16- |
| InChIKey | FFSBWEBPWQXNKJ-PGMHBOJBSA-N |
| XLogP | 4.18 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|