C20H28N2O4 — CID 4284362
N-(cyclohex-3-en-1-ylmethylideneamino)-3,4,5-triethoxybenzamide (PubChem CID 4284362) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethylideneamino)-3,4,5-triethoxybenzamide.
| Compound Name | N-(cyclohex-3-en-1-ylmethylideneamino)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 4284362 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethylideneamino)-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NN=CC2CC=CCC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H28N2O4/c1-4-24-17-12-16(13-18(25-5-2)19(17)26-6-3)20(23)22-21-14-15-10-8-7-9-11-15/h7-8,12-15H,4-6,9-11H2,1-3H3,(H,22,23) |
| InChIKey | DFBYNJYNYSHIIE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|