C24H31BrN2O2 — CID 17174712
(4-benzylpiperazin-1-yl)-(3-bromo-4-hexoxyphenyl)methanone (PubChem CID 17174712) has the molecular formula C24H31BrN2O2 and a molecular weight of 459.43 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-(3-bromo-4-hexoxyphenyl)methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-(3-bromo-4-hexoxyphenyl)methanone |
|---|---|
| PubChem CID | 17174712 |
| Molecular Formula | C24H31BrN2O2 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-(3-bromo-4-hexoxyphenyl)methanone |
| SMILES | CCCCCCOc1ccc(C(=O)N2CCN(Cc3ccccc3)CC2)cc1Br |
| InChI | InChI=1S/C24H31BrN2O2/c1-2-3-4-8-17-29-23-12-11-21(18-22(23)25)24(28)27-15-13-26(14-16-27)19-20-9-6-5-7-10-20/h5-7,9-12,18H,2-4,8,13-17,19H2,1H3 |
| InChIKey | JHFLNBSNBUTYHG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|