C27H28BrN3O2S — CID 17174814
N-(4-benzylpiperazine-1-carbothioyl)-3-bromo-4-(2-phenylethoxy)benzamide (PubChem CID 17174814) has the molecular formula C27H28BrN3O2S and a molecular weight of 538.51 g/mol. Its IUPAC name is N-(4-benzylpiperazine-1-carbothioyl)-3-bromo-4-(2-phenylethoxy)benzamide.
| Compound Name | N-(4-benzylpiperazine-1-carbothioyl)-3-bromo-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17174814 |
| Molecular Formula | C27H28BrN3O2S |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | N-(4-benzylpiperazine-1-carbothioyl)-3-bromo-4-(2-phenylethoxy)benzamide |
| SMILES | O=C(NC(=S)N1CCN(Cc2ccccc2)CC1)c1ccc(OCCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C27H28BrN3O2S/c28-24-19-23(11-12-25(24)33-18-13-21-7-3-1-4-8-21)26(32)29-27(34)31-16-14-30(15-17-31)20-22-9-5-2-6-10-22/h1-12,19H,13-18,20H2,(H,29,32,34) |
| InChIKey | RQZUMLYQLBDKQL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|