C15H19BrN2O4S — CID 17356881
3-bromo-4-(2-methoxyethoxy)-N-(morpholine-4-carbothioyl)benzamide (PubChem CID 17356881) has the molecular formula C15H19BrN2O4S and a molecular weight of 403.30 g/mol. Its IUPAC name is 3-bromo-4-(2-methoxyethoxy)-N-(morpholine-4-carbothioyl)benzamide.
| Compound Name | 3-bromo-4-(2-methoxyethoxy)-N-(morpholine-4-carbothioyl)benzamide |
|---|---|
| PubChem CID | 17356881 |
| Molecular Formula | C15H19BrN2O4S |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 3-bromo-4-(2-methoxyethoxy)-N-(morpholine-4-carbothioyl)benzamide |
| SMILES | COCCOc1ccc(C(=O)NC(=S)N2CCOCC2)cc1Br |
| InChI | InChI=1S/C15H19BrN2O4S/c1-20-8-9-22-13-3-2-11(10-12(13)16)14(19)17-15(23)18-4-6-21-7-5-18/h2-3,10H,4-9H2,1H3,(H,17,19,23) |
| InChIKey | NDEKYZMYXCPVDD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|