C19H27BrN2O2S — CID 17339658
3-bromo-4-(3-methylbutoxy)-N-(4-methylpiperidine-1-carbothioyl)benzamide (PubChem CID 17339658) has the molecular formula C19H27BrN2O2S and a molecular weight of 427.41 g/mol. Its IUPAC name is 3-bromo-4-(3-methylbutoxy)-N-(4-methylpiperidine-1-carbothioyl)benzamide.
| Compound Name | 3-bromo-4-(3-methylbutoxy)-N-(4-methylpiperidine-1-carbothioyl)benzamide |
|---|---|
| PubChem CID | 17339658 |
| Molecular Formula | C19H27BrN2O2S |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 3-bromo-4-(3-methylbutoxy)-N-(4-methylpiperidine-1-carbothioyl)benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)NC(=S)N2CCC(C)CC2)cc1Br |
| InChI | InChI=1S/C19H27BrN2O2S/c1-13(2)8-11-24-17-5-4-15(12-16(17)20)18(23)21-19(25)22-9-6-14(3)7-10-22/h4-5,12-14H,6-11H2,1-3H3,(H,21,23,25) |
| InChIKey | NHDQZGPRGGQFJE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|