C17H25BrN2O2S — CID 17137495
3-bromo-N-(butan-2-ylcarbamothioyl)-4-(3-methylbutoxy)benzamide (PubChem CID 17137495) has the molecular formula C17H25BrN2O2S and a molecular weight of 401.37 g/mol. Its IUPAC name is 3-bromo-N-(butan-2-ylcarbamothioyl)-4-(3-methylbutoxy)benzamide.
| Compound Name | 3-bromo-N-(butan-2-ylcarbamothioyl)-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17137495 |
| Molecular Formula | C17H25BrN2O2S |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 3-bromo-N-(butan-2-ylcarbamothioyl)-4-(3-methylbutoxy)benzamide |
| SMILES | CCC(C)NC(=S)NC(=O)c1ccc(OCCC(C)C)c(Br)c1 |
| InChI | InChI=1S/C17H25BrN2O2S/c1-5-12(4)19-17(23)20-16(21)13-6-7-15(14(18)10-13)22-9-8-11(2)3/h6-7,10-12H,5,8-9H2,1-4H3,(H2,19,20,21,23) |
| InChIKey | JGCAVAWYYPTFHT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|