C17H23BrN2O2S — CID 17352220
3-bromo-4-(2-methylpropoxy)-N-(piperidine-1-carbothioyl)benzamide (PubChem CID 17352220) has the molecular formula C17H23BrN2O2S and a molecular weight of 399.35 g/mol. Its IUPAC name is 3-bromo-4-(2-methylpropoxy)-N-(piperidine-1-carbothioyl)benzamide.
| Compound Name | 3-bromo-4-(2-methylpropoxy)-N-(piperidine-1-carbothioyl)benzamide |
|---|---|
| PubChem CID | 17352220 |
| Molecular Formula | C17H23BrN2O2S |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 3-bromo-4-(2-methylpropoxy)-N-(piperidine-1-carbothioyl)benzamide |
| SMILES | CC(C)COc1ccc(C(=O)NC(=S)N2CCCCC2)cc1Br |
| InChI | InChI=1S/C17H23BrN2O2S/c1-12(2)11-22-15-7-6-13(10-14(15)18)16(21)19-17(23)20-8-4-3-5-9-20/h6-7,10,12H,3-5,8-9,11H2,1-2H3,(H,19,21,23) |
| InChIKey | AEOIYACTTNYWSG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|