C21H24BrN3O2S — CID 17174815
N-(4-benzylpiperazine-1-carbothioyl)-3-bromo-4-ethoxybenzamide (PubChem CID 17174815) has the molecular formula C21H24BrN3O2S and a molecular weight of 462.41 g/mol. Its IUPAC name is N-(4-benzylpiperazine-1-carbothioyl)-3-bromo-4-ethoxybenzamide.
| Compound Name | N-(4-benzylpiperazine-1-carbothioyl)-3-bromo-4-ethoxybenzamide |
|---|---|
| PubChem CID | 17174815 |
| Molecular Formula | C21H24BrN3O2S |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | N-(4-benzylpiperazine-1-carbothioyl)-3-bromo-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)N2CCN(Cc3ccccc3)CC2)cc1Br |
| InChI | InChI=1S/C21H24BrN3O2S/c1-2-27-19-9-8-17(14-18(19)22)20(26)23-21(28)25-12-10-24(11-13-25)15-16-6-4-3-5-7-16/h3-9,14H,2,10-13,15H2,1H3,(H,23,26,28) |
| InChIKey | AIFHHZXTNRDYRL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|